C18H21N3S — CID 110377229
6-methyl-N-[4-(propylsulfanylmethyl)phenyl]-1H-benzimidazol-2-amine (PubChem CID 110377229) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 6-methyl-N-[4-(propylsulfanylmethyl)phenyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-methyl-N-[4-(propylsulfanylmethyl)phenyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110377229 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 6-methyl-N-[4-(propylsulfanylmethyl)phenyl]-1H-benzimidazol-2-amine |
| SMILES | CCCSCc1ccc(Nc2nc3ccc(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H21N3S/c1-3-10-22-12-14-5-7-15(8-6-14)19-18-20-16-9-4-13(2)11-17(16)21-18/h4-9,11H,3,10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | DGMBPRSEUYVHCT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|