C8H13N3O3 — CID 135631209
2-(2-hydroxyethylamino)-4-(methoxymethyl)-1H-pyrimidin-6-one (PubChem CID 135631209) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-4-(methoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2-hydroxyethylamino)-4-(methoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135631209 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(2-hydroxyethylamino)-4-(methoxymethyl)-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(NCCO)n1 |
| InChI | InChI=1S/C8H13N3O3/c1-14-5-6-4-7(13)11-8(10-6)9-2-3-12/h4,12H,2-3,5H2,1H3,(H2,9,10,11,13) |
| InChIKey | QIIARSDJMJWGIE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |