C13H24N4O — CID 136779917
2-[3-(diethylamino)propylamino]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 136779917) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[3-(diethylamino)propylamino]-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[3-(diethylamino)propylamino]-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136779917 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-[3-(diethylamino)propylamino]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(NCCCN(CC)CC)n1 |
| InChI | InChI=1S/C13H24N4O/c1-4-11-10-12(18)16-13(15-11)14-8-7-9-17(5-2)6-3/h10H,4-9H2,1-3H3,(H2,14,15,16,18) |
| InChIKey | ZSJNJYMUZVTNOU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|