C13H23ClN4 — CID 82460551
N-(2-chloro-6-ethylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 82460551) has the molecular formula C13H23ClN4 and a molecular weight of 270.81 g/mol. Its IUPAC name is N-(2-chloro-6-ethylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-6-ethylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82460551 |
| Molecular Formula | C13H23ClN4 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N-(2-chloro-6-ethylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCc1cc(NCCCN(CC)CC)nc(Cl)n1 |
| InChI | InChI=1S/C13H23ClN4/c1-4-11-10-12(17-13(14)16-11)15-8-7-9-18(5-2)6-3/h10H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | ANODIUMZONLATI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|