C12H21N3O2 — CID 136802055
4-ethyl-2-[[2-hydroxyethyl(propyl)amino]methyl]-1H-pyrimidin-6-one (PubChem CID 136802055) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-ethyl-2-[[2-hydroxyethyl(propyl)amino]methyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[[2-hydroxyethyl(propyl)amino]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136802055 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 4-ethyl-2-[[2-hydroxyethyl(propyl)amino]methyl]-1H-pyrimidin-6-one |
| SMILES | CCCN(CCO)Cc1nc(CC)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N3O2/c1-3-5-15(6-7-16)9-11-13-10(4-2)8-12(17)14-11/h8,16H,3-7,9H2,1-2H3,(H,13,14,17) |
| InChIKey | QFSWRSREKDWSGC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |