C9H19N5 — CID 83813459
N',N'-diethyl-N-(1H-1,2,4-triazol-5-yl)propane-1,3-diamine (PubChem CID 83813459) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is N',N'-diethyl-N-(1H-1,2,4-triazol-5-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(1H-1,2,4-triazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83813459 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | N',N'-diethyl-N-(1H-1,2,4-triazol-5-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ncn[nH]1 |
| InChI | InChI=1S/C9H19N5/c1-3-14(4-2)7-5-6-10-9-11-8-12-13-9/h8H,3-7H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | FICKQUDMHPJJMB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|