C14H17ClN5O2+ — CID 135500237
[amino-(3-chloro-2-methylanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium (PubChem CID 135500237) has the molecular formula C14H17ClN5O2+ and a molecular weight of 322.78 g/mol. Its IUPAC name is [amino-(3-chloro-2-methylanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium.
| Compound Name | [amino-(3-chloro-2-methylanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 135500237 |
| Molecular Formula | C14H17ClN5O2+ |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [amino-(3-chloro-2-methylanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium |
| SMILES | COCc1cc(=O)[nH]c([NH+]=C(N)Nc2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-8-10(15)4-3-5-11(8)18-13(16)20-14-17-9(7-22-2)6-12(21)19-14/h3-6H,7H2,1-2H3,(H4,16,17,18,19,20,21)/p+1 |
| InChIKey | IBTQESBGFHZRBM-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|