C14H15F3N5O+ — CID 135738710
[amino-(2,3-dimethylanilino)methylidene]-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]azanium (PubChem CID 135738710) has the molecular formula C14H15F3N5O+ and a molecular weight of 326.30 g/mol. Its IUPAC name is [amino-(2,3-dimethylanilino)methylidene]-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]azanium.
| Compound Name | [amino-(2,3-dimethylanilino)methylidene]-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 135738710 |
| Molecular Formula | C14H15F3N5O+ |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [amino-(2,3-dimethylanilino)methylidene]-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]azanium |
| SMILES | Cc1cccc(NC(N)=[NH+]c2nc(C(F)(F)F)cc(=O)[nH]2)c1C |
| InChI | InChI=1S/C14H14F3N5O/c1-7-4-3-5-9(8(7)2)19-12(18)22-13-20-10(14(15,16)17)6-11(23)21-13/h3-6H,1-2H3,(H4,18,19,20,21,22,23)/p+1 |
| InChIKey | ZSIRYYRORBEFAD-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|