C15H14F3N5O3 — CID 135402259
ethyl 3-[[N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidoyl]amino]benzoate (PubChem CID 135402259) has the molecular formula C15H14F3N5O3 and a molecular weight of 369.30 g/mol. Its IUPAC name is ethyl 3-[[N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidoyl]amino]benzoate.
| Compound Name | ethyl 3-[[N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 135402259 |
| Molecular Formula | C15H14F3N5O3 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 3-[[N'-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]carbamimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(N)=Nc2nc(C(F)(F)F)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C15H14F3N5O3/c1-2-26-12(25)8-4-3-5-9(6-8)20-13(19)23-14-21-10(15(16,17)18)7-11(24)22-14/h3-7H,2H2,1H3,(H4,19,20,21,22,23,24) |
| InChIKey | RCMNOQGRUMVCPF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|