C15H18ClN5O — CID 135996106
1-(3-chloro-2-methylphenyl)-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine (PubChem CID 135996106) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 135996106 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine |
| SMILES | CCCc1cc(=O)[nH]c(/N=C(\N)Nc2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C15H18ClN5O/c1-3-5-10-8-13(22)20-15(18-10)21-14(17)19-12-7-4-6-11(16)9(12)2/h4,6-8H,3,5H2,1-2H3,(H4,17,18,19,20,21,22) |
| InChIKey | RSCYYSLCXOUCHC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|