C14H17Cl2N5O — CID 163329156
1-(3-chloro-2-methylphenyl)-2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)guanidine;hydrochloride (PubChem CID 163329156) has the molecular formula C14H17Cl2N5O and a molecular weight of 342.23 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)guanidine;hydrochloride.
| Compound Name | 1-(3-chloro-2-methylphenyl)-2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 163329156 |
| Molecular Formula | C14H17Cl2N5O |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)guanidine;hydrochloride |
| SMILES | Cc1nc(/N=C(\N)Nc2cccc(Cl)c2C)[nH]c(=O)c1C.Cl |
| InChI | InChI=1S/C14H16ClN5O.ClH/c1-7-9(3)17-14(19-12(7)21)20-13(16)18-11-6-4-5-10(15)8(11)2;/h4-6H,1-3H3,(H4,16,17,18,19,20,21);1H |
| InChIKey | KYBXOXLIEYDFPM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|