C16H16ClN7OS2 — CID 136824265
1-(3-chloro-2-methylphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine (PubChem CID 136824265) has the molecular formula C16H16ClN7OS2 and a molecular weight of 421.94 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 136824265 |
| Molecular Formula | C16H16ClN7OS2 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]guanidine |
| SMILES | Cc1nnc(SCc2cc(=O)[nH]c(N=C(N)Nc3cccc(Cl)c3C)n2)s1 |
| InChI | InChI=1S/C16H16ClN7OS2/c1-8-11(17)4-3-5-12(8)20-14(18)22-15-19-10(6-13(25)21-15)7-26-16-24-23-9(2)27-16/h3-6H,7H2,1-2H3,(H4,18,19,20,21,22,25) |
| InChIKey | WBDNMIDQYSJCMI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|