C22H18ClN7O2S2 — CID 135526800
N-[(Z)-N-(3-chlorophenyl)-N'-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]carbamimidoyl]benzamide (PubChem CID 135526800) has the molecular formula C22H18ClN7O2S2 and a molecular weight of 512.02 g/mol. Its IUPAC name is N-[(Z)-N-(3-chlorophenyl)-N'-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]carbamimidoyl]benzamide.
| Compound Name | N-[(Z)-N-(3-chlorophenyl)-N'-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135526800 |
| Molecular Formula | C22H18ClN7O2S2 |
| Molecular Weight | 512.02 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | N-[(Z)-N-(3-chlorophenyl)-N'-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]carbamimidoyl]benzamide |
| SMILES | Cc1nnc(SCc2cc(=O)[nH]c(/N=C(\NC(=O)c3ccccc3)Nc3cccc(Cl)c3)n2)s1 |
| InChI | InChI=1S/C22H18ClN7O2S2/c1-13-29-30-22(34-13)33-12-17-11-18(31)26-20(25-17)28-21(24-16-9-5-8-15(23)10-16)27-19(32)14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H3,24,25,26,27,28,31,32) |
| InChIKey | XUWGSUONEGTYGY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.02 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|