C27H23ClFN5O2S — CID 135437348
N-[(Z)-N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-(2,4-dimethylphenyl)carbamimidoyl]-3-fluorobenzamide (PubChem CID 135437348) has the molecular formula C27H23ClFN5O2S and a molecular weight of 536.03 g/mol. Its IUPAC name is N-[(Z)-N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-(2,4-dimethylphenyl)carbamimidoyl]-3-fluorobenzamide.
| Compound Name | N-[(Z)-N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-(2,4-dimethylphenyl)carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 135437348 |
| Molecular Formula | C27H23ClFN5O2S |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | N-[(Z)-N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-(2,4-dimethylphenyl)carbamimidoyl]-3-fluorobenzamide |
| SMILES | Cc1ccc(N/C(=N/c2nc(CSc3ccc(Cl)cc3)cc(=O)[nH]2)NC(=O)c2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C27H23ClFN5O2S/c1-16-6-11-23(17(2)12-16)31-27(33-25(36)18-4-3-5-20(29)13-18)34-26-30-21(14-24(35)32-26)15-37-22-9-7-19(28)8-10-22/h3-14H,15H2,1-2H3,(H3,30,31,32,33,34,35,36) |
| InChIKey | PBLWUNGEEXYAPU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|