C29H22ClN5O2S — CID 135445787
N-[N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-naphthalen-1-ylcarbamimidoyl]benzamide (PubChem CID 135445787) has the molecular formula C29H22ClN5O2S and a molecular weight of 540.05 g/mol. Its IUPAC name is N-[N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-naphthalen-1-ylcarbamimidoyl]benzamide.
| Compound Name | N-[N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-naphthalen-1-ylcarbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135445787 |
| Molecular Formula | C29H22ClN5O2S |
| Molecular Weight | 540.05 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-[N'-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-N-naphthalen-1-ylcarbamimidoyl]benzamide |
| SMILES | O=C(NC(=Nc1nc(CSc2ccc(Cl)cc2)cc(=O)[nH]1)Nc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C29H22ClN5O2S/c30-21-13-15-23(16-14-21)38-18-22-17-26(36)33-28(31-22)35-29(34-27(37)20-8-2-1-3-9-20)32-25-12-6-10-19-7-4-5-11-24(19)25/h1-17H,18H2,(H3,31,32,33,34,35,36,37) |
| InChIKey | VGZQFUJZCHFQPN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.05 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|