C19H18ClN5O2S — CID 136824253
2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(2-methoxyphenyl)guanidine (PubChem CID 136824253) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(2-methoxyphenyl)guanidine.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(2-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 136824253 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(2-methoxyphenyl)guanidine |
| SMILES | COc1ccccc1NC(N)=Nc1nc(CSc2ccc(Cl)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H18ClN5O2S/c1-27-16-5-3-2-4-15(16)23-18(21)25-19-22-13(10-17(26)24-19)11-28-14-8-6-12(20)7-9-14/h2-10H,11H2,1H3,(H4,21,22,23,24,25,26) |
| InChIKey | GFQQTNBEVQCAGE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|