C18H15ClFN5OS — CID 135651122
2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(4-fluorophenyl)guanidine (PubChem CID 135651122) has the molecular formula C18H15ClFN5OS and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(4-fluorophenyl)guanidine.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(4-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 135651122 |
| Molecular Formula | C18H15ClFN5OS |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-(4-fluorophenyl)guanidine |
| SMILES | N/C(=N\c1nc(CSc2ccc(Cl)cc2)cc(=O)[nH]1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFN5OS/c19-11-1-7-15(8-2-11)27-10-14-9-16(26)24-18(23-14)25-17(21)22-13-5-3-12(20)4-6-13/h1-9H,10H2,(H4,21,22,23,24,25,26) |
| InChIKey | CCLORZUHQFXMGQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|