C16H18N7OS2+ — CID 135797972
[amino-(2-methylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium (PubChem CID 135797972) has the molecular formula C16H18N7OS2+ and a molecular weight of 388.50 g/mol. Its IUPAC name is [amino-(2-methylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium.
| Compound Name | [amino-(2-methylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 135797972 |
| Molecular Formula | C16H18N7OS2+ |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [amino-(2-methylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium |
| SMILES | Cc1nnc(SCc2cc(=O)[nH]c([NH+]=C(N)Nc3ccccc3C)n2)s1 |
| InChI | InChI=1S/C16H17N7OS2/c1-9-5-3-4-6-12(9)19-14(17)21-15-18-11(7-13(24)20-15)8-25-16-23-22-10(2)26-16/h3-7H,8H2,1-2H3,(H4,17,18,19,20,21,24)/p+1 |
| InChIKey | MTQBQWGDCJNHSO-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|