C15H15ClF3N5O — CID 135541631
1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine (PubChem CID 135541631) has the molecular formula C15H15ClF3N5O and a molecular weight of 373.77 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 135541631 |
| Molecular Formula | C15H15ClF3N5O |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)guanidine |
| SMILES | CCCc1cc(=O)[nH]c(N=C(N)Nc2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C15H15ClF3N5O/c1-2-3-9-7-12(25)23-14(21-9)24-13(20)22-11-6-8(15(17,18)19)4-5-10(11)16/h4-7H,2-3H2,1H3,(H4,20,21,22,23,24,25) |
| InChIKey | INXFSVLQUPPSAF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|