C15H19ClF3N3S — CID 54540300
1-(1-aminoheptylidene)-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 54540300) has the molecular formula C15H19ClF3N3S and a molecular weight of 365.85 g/mol. Its IUPAC name is 1-(1-aminoheptylidene)-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(1-aminoheptylidene)-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 54540300 |
| Molecular Formula | C15H19ClF3N3S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-(1-aminoheptylidene)-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCCCCCC(N)=NC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H19ClF3N3S/c1-2-3-4-5-6-13(20)22-14(23)21-12-9-10(15(17,18)19)7-8-11(12)16/h7-9H,2-6H2,1H3,(H3,20,21,22,23) |
| InChIKey | ZCRSTMUQCLMHMI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|