C12H14ClF3N2S2 — CID 4841868
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 4841868) has the molecular formula C12H14ClF3N2S2 and a molecular weight of 342.84 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 4841868 |
| Molecular Formula | C12H14ClF3N2S2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H14ClF3N2S2/c1-20-6-2-5-17-11(19)18-10-7-8(12(14,15)16)3-4-9(10)13/h3-4,7H,2,5-6H2,1H3,(H2,17,18,19) |
| InChIKey | ABINNHUTVVYZKO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|