C14H18N5O+ — CID 135522600
[amino-(3-methylanilino)methylidene]-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)azanium (PubChem CID 135522600) has the molecular formula C14H18N5O+ and a molecular weight of 272.33 g/mol. Its IUPAC name is [amino-(3-methylanilino)methylidene]-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)azanium.
| Compound Name | [amino-(3-methylanilino)methylidene]-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)azanium |
|---|---|
| PubChem CID | 135522600 |
| Molecular Formula | C14H18N5O+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [amino-(3-methylanilino)methylidene]-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)azanium |
| SMILES | Cc1cccc(NC(N)=[NH+]c2nc(C)c(C)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H17N5O/c1-8-5-4-6-11(7-8)17-13(15)19-14-16-10(3)9(2)12(20)18-14/h4-7H,1-3H3,(H4,15,16,17,18,19,20)/p+1 |
| InChIKey | MFQKXHSXVOWNCY-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|