C16H20N5O+ — CID 135441043
[amino-(3-methylanilino)methylidene]-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)azanium (PubChem CID 135441043) has the molecular formula C16H20N5O+ and a molecular weight of 298.37 g/mol. Its IUPAC name is [amino-(3-methylanilino)methylidene]-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)azanium.
| Compound Name | [amino-(3-methylanilino)methylidene]-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)azanium |
|---|---|
| PubChem CID | 135441043 |
| Molecular Formula | C16H20N5O+ |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [amino-(3-methylanilino)methylidene]-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)azanium |
| SMILES | Cc1cccc(NC(N)=[NH+]c2nc3c(c(=O)[nH]2)CCCC3)c1 |
| InChI | InChI=1S/C16H19N5O/c1-10-5-4-6-11(9-10)18-15(17)21-16-19-13-8-3-2-7-12(13)14(22)20-16/h4-6,9H,2-3,7-8H2,1H3,(H4,17,18,19,20,21,22)/p+1 |
| InChIKey | UEFCYPAHBXDIQQ-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|