C16H18N5O3+ — CID 135505066
[amino-(2,3-dihydro-1,4-benzodioxin-6-ylamino)methylidene]-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)azanium (PubChem CID 135505066) has the molecular formula C16H18N5O3+ and a molecular weight of 328.35 g/mol. Its IUPAC name is [amino-(2,3-dihydro-1,4-benzodioxin-6-ylamino)methylidene]-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)azanium.
| Compound Name | [amino-(2,3-dihydro-1,4-benzodioxin-6-ylamino)methylidene]-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)azanium |
|---|---|
| PubChem CID | 135505066 |
| Molecular Formula | C16H18N5O3+ |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [amino-(2,3-dihydro-1,4-benzodioxin-6-ylamino)methylidene]-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)azanium |
| SMILES | NC(Nc1ccc2c(c1)OCCO2)=[NH+]c1nc2c(c(=O)[nH]1)CCC2 |
| InChI | InChI=1S/C16H17N5O3/c17-15(18-9-4-5-12-13(8-9)24-7-6-23-12)21-16-19-11-3-1-2-10(11)14(22)20-16/h4-5,8H,1-3,6-7H2,(H4,17,18,19,20,21,22)/p+1 |
| InChIKey | YQDLAYNTWHHDKX-UHFFFAOYSA-O |
| XLogP | -0.83 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|