C24H25N5O2 — CID 135515813
4-methyl-N-[(Z)-N-(3-methylphenyl)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)carbamimidoyl]benzamide (PubChem CID 135515813) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-N-(3-methylphenyl)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)carbamimidoyl]benzamide.
| Compound Name | 4-methyl-N-[(Z)-N-(3-methylphenyl)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135515813 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-methyl-N-[(Z)-N-(3-methylphenyl)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(C(=O)N/C(=N\c2nc3c(c(=O)[nH]2)CCCC3)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-15-10-12-17(13-11-15)21(30)27-23(25-18-7-5-6-16(2)14-18)29-24-26-20-9-4-3-8-19(20)22(31)28-24/h5-7,10-14H,3-4,8-9H2,1-2H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | RFHIKBHCAYJFLY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|