C14H11F6N5 — CID 71550817
2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 71550817) has the molecular formula C14H11F6N5 and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 71550817 |
| Molecular Formula | C14H11F6N5 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1cc(C(F)(F)F)nc(/N=C(\N)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11F6N5/c1-7-6-10(14(18,19)20)24-12(22-7)25-11(21)23-9-5-3-2-4-8(9)13(15,16)17/h2-6H,1H3,(H3,21,22,23,24,25) |
| InChIKey | DMIYZPSMBHPOFW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|