C14H11F6N5 — CID 85039824
2-[4,6-bis(trifluoromethyl)pyrimidin-2-yl]-1-(4-methylphenyl)guanidine (PubChem CID 85039824) has the molecular formula C14H11F6N5 and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-[4,6-bis(trifluoromethyl)pyrimidin-2-yl]-1-(4-methylphenyl)guanidine.
| Compound Name | 2-[4,6-bis(trifluoromethyl)pyrimidin-2-yl]-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 85039824 |
| Molecular Formula | C14H11F6N5 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[4,6-bis(trifluoromethyl)pyrimidin-2-yl]-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(NC(N)=Nc2nc(C(F)(F)F)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H11F6N5/c1-7-2-4-8(5-3-7)22-11(21)25-12-23-9(13(15,16)17)6-10(24-12)14(18,19)20/h2-6H,1H3,(H3,21,22,23,24,25) |
| InChIKey | FAHJKGAQQVLUNQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|