C14H15N5O5S2 — CID 21176411
4-[(2Z)-2-[1-(benzenesulfonyl)-2-hydrazinyl-2-oxoethylidene]hydrazinyl]benzenesulfonamide (PubChem CID 21176411) has the molecular formula C14H15N5O5S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-(benzenesulfonyl)-2-hydrazinyl-2-oxoethylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[1-(benzenesulfonyl)-2-hydrazinyl-2-oxoethylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 21176411 |
| Molecular Formula | C14H15N5O5S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-[(2Z)-2-[1-(benzenesulfonyl)-2-hydrazinyl-2-oxoethylidene]hydrazinyl]benzenesulfonamide |
| SMILES | NNC(=O)/C(=N/Nc1ccc(S(N)(=O)=O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N5O5S2/c15-17-13(20)14(25(21,22)11-4-2-1-3-5-11)19-18-10-6-8-12(9-7-10)26(16,23)24/h1-9,18H,15H2,(H,17,20)(H2,16,23,24)/b19-14- |
| InChIKey | VDFYENOSSMLVFD-RGEXLXHISA-N |
| XLogP | -0.48 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|