C15H15ClN4O4S — CID 21176413
(2Z)-2-(benzenesulfonyl)-2-[(5-chloro-2-methoxyphenyl)hydrazinylidene]acetohydrazide (PubChem CID 21176413) has the molecular formula C15H15ClN4O4S and a molecular weight of 382.83 g/mol. Its IUPAC name is (2Z)-2-(benzenesulfonyl)-2-[(5-chloro-2-methoxyphenyl)hydrazinylidene]acetohydrazide.
| Compound Name | (2Z)-2-(benzenesulfonyl)-2-[(5-chloro-2-methoxyphenyl)hydrazinylidene]acetohydrazide |
|---|---|
| PubChem CID | 21176413 |
| Molecular Formula | C15H15ClN4O4S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (2Z)-2-(benzenesulfonyl)-2-[(5-chloro-2-methoxyphenyl)hydrazinylidene]acetohydrazide |
| SMILES | COc1ccc(Cl)cc1N/N=C(/C(=O)NN)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15ClN4O4S/c1-24-13-8-7-10(16)9-12(13)19-20-15(14(21)18-17)25(22,23)11-5-3-2-4-6-11/h2-9,19H,17H2,1H3,(H,18,21)/b20-15- |
| InChIKey | QONDRGBGKQZYFP-HKWRFOASSA-N |
| XLogP | 1.54 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|