C15H14F3N3O2S — CID 85329773
4-[2-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)hydrazinyl]benzenesulfonamide (PubChem CID 85329773) has the molecular formula C15H14F3N3O2S and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-[2-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[2-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 85329773 |
| Molecular Formula | C15H14F3N3O2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-[2-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)hydrazinyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NN=C(Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3N3O2S/c16-15(17,18)14(10-11-4-2-1-3-5-11)21-20-12-6-8-13(9-7-12)24(19,22)23/h1-9,20H,10H2,(H2,19,22,23) |
| InChIKey | PHOCCNPDCYUYHO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|