C13H15N5O3S — CID 134103700
(1E)-2-oxo-2-pyrrolidin-1-yl-N-(4-sulfamoylanilino)ethanimidoyl cyanide (PubChem CID 134103700) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is (1E)-2-oxo-2-pyrrolidin-1-yl-N-(4-sulfamoylanilino)ethanimidoyl cyanide.
| Compound Name | (1E)-2-oxo-2-pyrrolidin-1-yl-N-(4-sulfamoylanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 134103700 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (1E)-2-oxo-2-pyrrolidin-1-yl-N-(4-sulfamoylanilino)ethanimidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H15N5O3S/c14-9-12(13(19)18-7-1-2-8-18)17-16-10-3-5-11(6-4-10)22(15,20)21/h3-6,16H,1-2,7-8H2,(H2,15,20,21)/b17-12+ |
| InChIKey | YVPCKIAVZGXAGI-SFQUDFHCSA-N |
| XLogP | 0.25 |
| TPSA | 128.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|