C14H15N5O3 — CID 134118632
(1E)-N-(4-methyl-2-nitroanilino)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide (PubChem CID 134118632) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is (1E)-N-(4-methyl-2-nitroanilino)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide.
| Compound Name | (1E)-N-(4-methyl-2-nitroanilino)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide |
|---|---|
| PubChem CID | 134118632 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (1E)-N-(4-methyl-2-nitroanilino)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide |
| SMILES | Cc1ccc(N/N=C(\C#N)C(=O)N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O3/c1-10-4-5-11(13(8-10)19(21)22)16-17-12(9-15)14(20)18-6-2-3-7-18/h4-5,8,16H,2-3,6-7H2,1H3/b17-12+ |
| InChIKey | ZQBUTRNFZAQERB-SFQUDFHCSA-N |
| XLogP | 1.82 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|