C12H18N2O3 — CID 81411428
2,2-dimethyl-3-(4-methyl-2-nitroanilino)propan-1-ol (PubChem CID 81411428) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methyl-2-nitroanilino)propan-1-ol.
| Compound Name | 2,2-dimethyl-3-(4-methyl-2-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 81411428 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2,2-dimethyl-3-(4-methyl-2-nitroanilino)propan-1-ol |
| SMILES | Cc1ccc(NCC(C)(C)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N2O3/c1-9-4-5-10(11(6-9)14(16)17)13-7-12(2,3)8-15/h4-6,13,15H,7-8H2,1-3H3 |
| InChIKey | YVYJRVBILRLKGQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|