C11H14BrFN2O3 — CID 113294087
3-(4-bromo-5-fluoro-2-nitroanilino)-2,2-dimethylpropan-1-ol (PubChem CID 113294087) has the molecular formula C11H14BrFN2O3 and a molecular weight of 321.15 g/mol. Its IUPAC name is 3-(4-bromo-5-fluoro-2-nitroanilino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(4-bromo-5-fluoro-2-nitroanilino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 113294087 |
| Molecular Formula | C11H14BrFN2O3 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-(4-bromo-5-fluoro-2-nitroanilino)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14BrFN2O3/c1-11(2,6-16)5-14-9-4-8(13)7(12)3-10(9)15(17)18/h3-4,14,16H,5-6H2,1-2H3 |
| InChIKey | WPGXAKHAAOIHIM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|