C13H18BrFN2O3 — CID 106145185
5-(4-bromo-5-fluoro-2-nitroanilino)-4,4-dimethylpentan-1-ol (PubChem CID 106145185) has the molecular formula C13H18BrFN2O3 and a molecular weight of 349.20 g/mol. Its IUPAC name is 5-(4-bromo-5-fluoro-2-nitroanilino)-4,4-dimethylpentan-1-ol.
| Compound Name | 5-(4-bromo-5-fluoro-2-nitroanilino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106145185 |
| Molecular Formula | C13H18BrFN2O3 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-(4-bromo-5-fluoro-2-nitroanilino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrFN2O3/c1-13(2,4-3-5-18)8-16-11-7-10(15)9(14)6-12(11)17(19)20/h6-7,16,18H,3-5,8H2,1-2H3 |
| InChIKey | AXUXGMFDDVZBEQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|