C15H14N6O3 — CID 6140980
(1E)-N-(2-nitroanilino)-2-oxo-2-(3,4,5-trimethylpyrazol-1-yl)ethanimidoyl cyanide (PubChem CID 6140980) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is (1E)-N-(2-nitroanilino)-2-oxo-2-(3,4,5-trimethylpyrazol-1-yl)ethanimidoyl cyanide.
| Compound Name | (1E)-N-(2-nitroanilino)-2-oxo-2-(3,4,5-trimethylpyrazol-1-yl)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 6140980 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (1E)-N-(2-nitroanilino)-2-oxo-2-(3,4,5-trimethylpyrazol-1-yl)ethanimidoyl cyanide |
| SMILES | Cc1nn(C(=O)/C(C#N)=N/Nc2ccccc2[N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C15H14N6O3/c1-9-10(2)19-20(11(9)3)15(22)13(8-16)18-17-12-6-4-5-7-14(12)21(23)24/h4-7,17H,1-3H3/b18-13+ |
| InChIKey | CCVQMQINCJUVSY-QGOAFFKASA-N |
| XLogP | 2.35 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|