About 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide
2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide (PubChem CID 4843927) has the molecular formula C23H23N7O3S
and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide.
Molecular Properties
| Compound Name | 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide |
| PubChem CID | 4843927 |
| Molecular Formula | C23H23N7O3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C#N)=NNc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C23H23N7O3S/c1-3-16-7-5-8-17(4-2)21(16)27-22(31)20(15-24)29-28-18-9-11-19(12-10-18)34(32,33)30-23-25-13-6-14-26-23/h5-14,28H,3-4H2,1-2H3,(H,27,31)(H,25,26,30) |
| InChIKey | BEIZBLZFFLOHTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide?
The IUPAC name of 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide (CID 4843927) is 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide.
What is the SMILES notation for 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide?
The canonical SMILES for 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide is CCc1cccc(CC)c1NC(=O)C(C#N)=NNc1ccc(S(=O)(=O)Nc2ncccn2)cc1.
What is the InChIKey of 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide?
The InChIKey is BEIZBLZFFLOHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N7O3S/c1-3-16-7-5-8-17(4-2)21(16)27-22(31)20(15-24)29-28-18-9-11-19(12-10-18)34(32,33)30-23-25-13-6-14-26-23/h5-14,28H,3-4H2,1-2H3,(H,27,31)(H,25,26,30).
What are the key properties of 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide?
2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide has a molecular weight of 477.55 g/mol, XLogP of 3.33, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diethylanilino)-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethanimidoyl cyanide is sourced from PubChem (CID 4843927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).