C22H19N7O5S — CID 4848422
2-[[2-cyano-2-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetyl]amino]benzoic acid (PubChem CID 4848422) has the molecular formula C22H19N7O5S and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-[[2-cyano-2-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-cyano-2-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4848422 |
| Molecular Formula | C22H19N7O5S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[[2-cyano-2-[[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetyl]amino]benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NN=C(C#N)C(=O)Nc3ccccc3C(=O)O)cc2)nc(C)n1 |
| InChI | InChI=1S/C22H19N7O5S/c1-13-11-20(25-14(2)24-13)29-35(33,34)16-9-7-15(8-10-16)27-28-19(12-23)21(30)26-18-6-4-3-5-17(18)22(31)32/h3-11,27H,1-2H3,(H,26,30)(H,31,32)(H,24,25,29) |
| InChIKey | DUKUJOCQVPXDPA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 186.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|