C17H9Cl4N3O4 — CID 98389681
(3R,4E)-N,1-bis(3,4-dichlorophenyl)-4-hydroxyimino-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 98389681) has the molecular formula C17H9Cl4N3O4 and a molecular weight of 461.09 g/mol. Its IUPAC name is (3R,4E)-N,1-bis(3,4-dichlorophenyl)-4-hydroxyimino-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4E)-N,1-bis(3,4-dichlorophenyl)-4-hydroxyimino-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98389681 |
| Molecular Formula | C17H9Cl4N3O4 |
| Molecular Weight | 461.09 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | (3R,4E)-N,1-bis(3,4-dichlorophenyl)-4-hydroxyimino-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@@H]1C(=O)N(c2ccc(Cl)c(Cl)c2)C(=O)/C1=N/O |
| InChI | InChI=1S/C17H9Cl4N3O4/c18-9-3-1-7(5-11(9)20)22-15(25)13-14(23-28)17(27)24(16(13)26)8-2-4-10(19)12(21)6-8/h1-6,13,28H,(H,22,25)/b23-14+/t13-/m1/s1 |
| InChIKey | WPRRKHZUQPPHGI-DZOGZAPRSA-N |
| XLogP | 4.26 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|