C25H17Cl6N5O3 — CID 3588078
N,1,3-tris(3,4-dichlorophenyl)-2,4-dioxo-6,7,8,9a-tetrahydropyrimido[1,2-a][1,3,5]triazine-9-carboxamide (PubChem CID 3588078) has the molecular formula C25H17Cl6N5O3 and a molecular weight of 648.16 g/mol. Its IUPAC name is N,1,3-tris(3,4-dichlorophenyl)-2,4-dioxo-6,7,8,9a-tetrahydropyrimido[1,2-a][1,3,5]triazine-9-carboxamide.
| Compound Name | N,1,3-tris(3,4-dichlorophenyl)-2,4-dioxo-6,7,8,9a-tetrahydropyrimido[1,2-a][1,3,5]triazine-9-carboxamide |
|---|---|
| PubChem CID | 3588078 |
| Molecular Formula | C25H17Cl6N5O3 |
| Molecular Weight | 648.16 g/mol |
| Exact Mass | 644.95 |
| IUPAC Name | N,1,3-tris(3,4-dichlorophenyl)-2,4-dioxo-6,7,8,9a-tetrahydropyrimido[1,2-a][1,3,5]triazine-9-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CCCN2C(=O)N(c3ccc(Cl)c(Cl)c3)C(=O)N(c3ccc(Cl)c(Cl)c3)C12 |
| InChI | InChI=1S/C25H17Cl6N5O3/c26-16-5-2-13(10-19(16)29)32-22(37)33-8-1-9-34-23(33)35(14-3-6-17(27)20(30)11-14)25(39)36(24(34)38)15-4-7-18(28)21(31)12-15/h2-7,10-12,23H,1,8-9H2,(H,32,37) |
| InChIKey | VDSZZQLNZGNJCG-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.16 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |