C24H26Cl4N4O3 — CID 3468223
1-[1-cyclohexyl-3-(3,4-dichlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea (PubChem CID 3468223) has the molecular formula C24H26Cl4N4O3 and a molecular weight of 560.31 g/mol. Its IUPAC name is 1-[1-cyclohexyl-3-(3,4-dichlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[1-cyclohexyl-3-(3,4-dichlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 3468223 |
| Molecular Formula | C24H26Cl4N4O3 |
| Molecular Weight | 560.31 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 1-[1-cyclohexyl-3-(3,4-dichlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea |
| SMILES | CC1(C)C(N(O)C(=O)Nc2ccc(Cl)c(Cl)c2)N(c2ccc(Cl)c(Cl)c2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C24H26Cl4N4O3/c1-24(2)21(32(35)22(33)29-14-8-10-17(25)19(27)12-14)30(16-9-11-18(26)20(28)13-16)23(34)31(24)15-6-4-3-5-7-15/h8-13,15,21,35H,3-7H2,1-2H3,(H,29,33) |
| InChIKey | PYMJUQAHFUJSHQ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|