C18H17Cl3N4O4 — CID 40879539
1-[(4R)-3-(3-chlorophenyl)-1-hydroxy-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea (PubChem CID 40879539) has the molecular formula C18H17Cl3N4O4 and a molecular weight of 459.72 g/mol. Its IUPAC name is 1-[(4R)-3-(3-chlorophenyl)-1-hydroxy-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[(4R)-3-(3-chlorophenyl)-1-hydroxy-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 40879539 |
| Molecular Formula | C18H17Cl3N4O4 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 1-[(4R)-3-(3-chlorophenyl)-1-hydroxy-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3,4-dichlorophenyl)-1-hydroxyurea |
| SMILES | CC1(C)[C@@H](N(O)C(=O)Nc2ccc(Cl)c(Cl)c2)N(c2cccc(Cl)c2)C(=O)N1O |
| InChI | InChI=1S/C18H17Cl3N4O4/c1-18(2)15(23(17(27)25(18)29)12-5-3-4-10(19)8-12)24(28)16(26)22-11-6-7-13(20)14(21)9-11/h3-9,15,28-29H,1-2H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | DMQIYYIHXJKZCP-OAHLLOKOSA-N |
| XLogP | 5.31 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|