C26H26Cl2N4O3 — CID 3730045
3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1-(2-phenylethyl)imidazolidin-4-yl]-1-hydroxyurea (PubChem CID 3730045) has the molecular formula C26H26Cl2N4O3 and a molecular weight of 513.43 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1-(2-phenylethyl)imidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1-(2-phenylethyl)imidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 3730045 |
| Molecular Formula | C26H26Cl2N4O3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1-(2-phenylethyl)imidazolidin-4-yl]-1-hydroxyurea |
| SMILES | CC1(C)C(N(O)C(=O)Nc2cccc(Cl)c2)N(c2cccc(Cl)c2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C26H26Cl2N4O3/c1-26(2)23(32(35)24(33)29-21-12-6-10-19(27)16-21)31(22-13-7-11-20(28)17-22)25(34)30(26)15-14-18-8-4-3-5-9-18/h3-13,16-17,23,35H,14-15H2,1-2H3,(H,29,33) |
| InChIKey | GIKHXEUTRYHSES-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|