C27H28Cl2N4O4 — CID 3263607
3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[2-(4-methoxyphenyl)ethyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea (PubChem CID 3263607) has the molecular formula C27H28Cl2N4O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[2-(4-methoxyphenyl)ethyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[2-(4-methoxyphenyl)ethyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 3263607 |
| Molecular Formula | C27H28Cl2N4O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[2-(4-methoxyphenyl)ethyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
| SMILES | COc1ccc(CCN2C(=O)N(c3cccc(Cl)c3)C(N(O)C(=O)Nc3cccc(Cl)c3)C2(C)C)cc1 |
| InChI | InChI=1S/C27H28Cl2N4O4/c1-27(2)24(33(36)25(34)30-21-8-4-6-19(28)16-21)32(22-9-5-7-20(29)17-22)26(35)31(27)15-14-18-10-12-23(37-3)13-11-18/h4-13,16-17,24,36H,14-15H2,1-3H3,(H,30,34) |
| InChIKey | OLPYVILIJIUHLC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|