C26H26Cl2N4O4 — CID 3720965
3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea (PubChem CID 3720965) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 3720965 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-(3-chlorophenyl)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
| SMILES | COc1ccc(CN2C(=O)N(c3cccc(Cl)c3)C(N(O)C(=O)Nc3cccc(Cl)c3)C2(C)C)cc1 |
| InChI | InChI=1S/C26H26Cl2N4O4/c1-26(2)23(32(35)24(33)29-20-8-4-6-18(27)14-20)31(21-9-5-7-19(28)15-21)25(34)30(26)16-17-10-12-22(36-3)13-11-17/h4-15,23,35H,16H2,1-3H3,(H,29,33) |
| InChIKey | CRPZYUJCRWARDO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|