C22H26Cl2N4O3 — CID 26442979
1-[(4R)-1-butyl-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea (PubChem CID 26442979) has the molecular formula C22H26Cl2N4O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is 1-[(4R)-1-butyl-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[(4R)-1-butyl-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 26442979 |
| Molecular Formula | C22H26Cl2N4O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-[(4R)-1-butyl-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea |
| SMILES | CCCCN1C(=O)N(c2cccc(Cl)c2)[C@H](N(O)C(=O)Nc2cccc(Cl)c2)C1(C)C |
| InChI | InChI=1S/C22H26Cl2N4O3/c1-4-5-12-26-21(30)27(18-11-7-9-16(24)14-18)19(22(26,2)3)28(31)20(29)25-17-10-6-8-15(23)13-17/h6-11,13-14,19,31H,4-5,12H2,1-3H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | FUAGUIQTWSKTLA-LJQANCHMSA-N |
| XLogP | 6.06 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|