C27H28Cl2N4O5 — CID 98379520
3-(3-chlorophenyl)-1-[(4R)-3-(3-chlorophenyl)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea (PubChem CID 98379520) has the molecular formula C27H28Cl2N4O5 and a molecular weight of 559.45 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(4R)-3-(3-chlorophenyl)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3-chlorophenyl)-1-[(4R)-3-(3-chlorophenyl)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 98379520 |
| Molecular Formula | C27H28Cl2N4O5 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(4R)-3-(3-chlorophenyl)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
| SMILES | COc1cc(CN2C(=O)N(c3cccc(Cl)c3)[C@H](N(O)C(=O)Nc3cccc(Cl)c3)C2(C)C)cc(OC)c1 |
| InChI | InChI=1S/C27H28Cl2N4O5/c1-27(2)24(33(36)25(34)30-20-9-5-7-18(28)13-20)32(21-10-6-8-19(29)14-21)26(35)31(27)16-17-11-22(37-3)15-23(12-17)38-4/h5-15,24,36H,16H2,1-4H3,(H,30,34)/t24-/m1/s1 |
| InChIKey | BHFQQRSNVKKOGL-XMMPIXPASA-N |
| XLogP | 6.48 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|