C27H30N4O5 — CID 40877409
1-[(4R)-1-[(2,3-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea (PubChem CID 40877409) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 1-[(4R)-1-[(2,3-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea.
| Compound Name | 1-[(4R)-1-[(2,3-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea |
|---|---|
| PubChem CID | 40877409 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[(4R)-1-[(2,3-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea |
| SMILES | COc1cccc(CN2C(=O)N(c3ccccc3)[C@H](N(O)C(=O)Nc3ccccc3)C2(C)C)c1OC |
| InChI | InChI=1S/C27H30N4O5/c1-27(2)24(31(34)25(32)28-20-13-7-5-8-14-20)30(21-15-9-6-10-16-21)26(33)29(27)18-19-12-11-17-22(35-3)23(19)36-4/h5-17,24,34H,18H2,1-4H3,(H,28,32)/t24-/m1/s1 |
| InChIKey | XYPMLINVDKHTKU-XMMPIXPASA-N |
| XLogP | 5.17 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|