C20H22ClN3O3S2 — CID 3780793
3-(3-chlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea (PubChem CID 3780793) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea |
|---|---|
| PubChem CID | 3780793 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-(3-chlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea |
| SMILES | COc1ccccc1CN1C(=S)SC(C)(C)C1N(O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O3S2/c1-20(2)17(24(26)18(25)22-15-9-6-8-14(21)11-15)23(19(28)29-20)12-13-7-4-5-10-16(13)27-3/h4-11,17,26H,12H2,1-3H3,(H,22,25) |
| InChIKey | TWVZSPBQHGZNBO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|