C19H20ClN5O3S2 — CID 2829498
3-(4-chlorophenyl)-1-[5,5-dimethyl-3-(phenylcarbamoylamino)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 2829498) has the molecular formula C19H20ClN5O3S2 and a molecular weight of 465.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[5,5-dimethyl-3-(phenylcarbamoylamino)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(4-chlorophenyl)-1-[5,5-dimethyl-3-(phenylcarbamoylamino)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 2829498 |
| Molecular Formula | C19H20ClN5O3S2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[5,5-dimethyl-3-(phenylcarbamoylamino)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | CC1(C)SC(=S)N(NC(=O)Nc2ccccc2)C1N(O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN5O3S2/c1-19(2)15(25(28)17(27)22-14-10-8-12(20)9-11-14)24(18(29)30-19)23-16(26)21-13-6-4-3-5-7-13/h3-11,15,28H,1-2H3,(H,22,27)(H2,21,23,26) |
| InChIKey | NVTDQLVGOQJGLR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|